C19H26N2O3S — CID 131956185
1-(benzenesulfonyl)-N-(2-bicyclo[2.2.1]heptanyl)piperidine-4-carboxamide (PubChem CID 131956185) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(2-bicyclo[2.2.1]heptanyl)piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(2-bicyclo[2.2.1]heptanyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 131956185 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(2-bicyclo[2.2.1]heptanyl)piperidine-4-carboxamide |
| SMILES | O=C(NC1CC2CCC1C2)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N2O3S/c22-19(20-18-13-14-6-7-16(18)12-14)15-8-10-21(11-9-15)25(23,24)17-4-2-1-3-5-17/h1-5,14-16,18H,6-13H2,(H,20,22) |
| InChIKey | RVWNVNICSWRJKY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |