C27H34N4O5S — CID 93013562
(3S)-1-(4-acetamidophenyl)sulfonyl-N-[(1R,2R)-2-benzamidocyclohexyl]piperidine-3-carboxamide (PubChem CID 93013562) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is (3S)-1-(4-acetamidophenyl)sulfonyl-N-[(1R,2R)-2-benzamidocyclohexyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-acetamidophenyl)sulfonyl-N-[(1R,2R)-2-benzamidocyclohexyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93013562 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (3S)-1-(4-acetamidophenyl)sulfonyl-N-[(1R,2R)-2-benzamidocyclohexyl]piperidine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)N[C@@H]3CCCC[C@H]3NC(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H34N4O5S/c1-19(32)28-22-13-15-23(16-14-22)37(35,36)31-17-7-10-21(18-31)27(34)30-25-12-6-5-11-24(25)29-26(33)20-8-3-2-4-9-20/h2-4,8-9,13-16,21,24-25H,5-7,10-12,17-18H2,1H3,(H,28,32)(H,29,33)(H,30,34)/t21-,24+,25+/m0/s1 |
| InChIKey | BSLFYUFDIMAMFA-FTBPSBKWSA-N |
| XLogP | 2.90 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |