C27H43N3O4S — CID 51070997
N-[(1R,2R)-2-benzamidocyclohexyl]-1-octylsulfonylpiperidine-3-carboxamide (PubChem CID 51070997) has the molecular formula C27H43N3O4S and a molecular weight of 505.73 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzamidocyclohexyl]-1-octylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-octylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51070997 |
| Molecular Formula | C27H43N3O4S |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-octylsulfonylpiperidine-3-carboxamide |
| SMILES | CCCCCCCCS(=O)(=O)N1CCCC(C(=O)N[C@@H]2CCCC[C@H]2NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C27H43N3O4S/c1-2-3-4-5-6-12-20-35(33,34)30-19-13-16-23(21-30)27(32)29-25-18-11-10-17-24(25)28-26(31)22-14-8-7-9-15-22/h7-9,14-15,23-25H,2-6,10-13,16-21H2,1H3,(H,28,31)(H,29,32)/t23?,24-,25-/m1/s1 |
| InChIKey | QJDAWXMSNGARPX-OPWSDZRHSA-N |
| XLogP | 4.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|