C26H38FN3O3 — CID 93013723
(3R)-N-[(1R,2R)-2-[(4-fluorobenzoyl)amino]cyclohexyl]-1-heptanoylpiperidine-3-carboxamide (PubChem CID 93013723) has the molecular formula C26H38FN3O3 and a molecular weight of 459.61 g/mol. Its IUPAC name is (3R)-N-[(1R,2R)-2-[(4-fluorobenzoyl)amino]cyclohexyl]-1-heptanoylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[(1R,2R)-2-[(4-fluorobenzoyl)amino]cyclohexyl]-1-heptanoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 93013723 |
| Molecular Formula | C26H38FN3O3 |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | (3R)-N-[(1R,2R)-2-[(4-fluorobenzoyl)amino]cyclohexyl]-1-heptanoylpiperidine-3-carboxamide |
| SMILES | CCCCCCC(=O)N1CCC[C@@H](C(=O)N[C@@H]2CCCC[C@H]2NC(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H38FN3O3/c1-2-3-4-5-12-24(31)30-17-8-9-20(18-30)26(33)29-23-11-7-6-10-22(23)28-25(32)19-13-15-21(27)16-14-19/h13-16,20,22-23H,2-12,17-18H2,1H3,(H,28,32)(H,29,33)/t20-,22-,23-/m1/s1 |
| InChIKey | XLLONXHUCGHCEN-YMPZKCBVSA-N |
| XLogP | 4.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|