C29H45N3O3 — CID 51071092
N-[(1R,2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]-1-nonanoylpiperidine-4-carboxamide (PubChem CID 51071092) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is N-[(1R,2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]-1-nonanoylpiperidine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]-1-nonanoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51071092 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | N-[(1R,2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]-1-nonanoylpiperidine-4-carboxamide |
| SMILES | CCCCCCCCC(=O)N1CCC(C(=O)N[C@@H]2CCCC[C@H]2NC(=O)c2ccccc2C)CC1 |
| InChI | InChI=1S/C29H45N3O3/c1-3-4-5-6-7-8-17-27(33)32-20-18-23(19-21-32)28(34)30-25-15-11-12-16-26(25)31-29(35)24-14-10-9-13-22(24)2/h9-10,13-14,23,25-26H,3-8,11-12,15-21H2,1-2H3,(H,30,34)(H,31,35)/t25-,26-/m1/s1 |
| InChIKey | GOLHPZXJOIVIMG-CLJLJLNGSA-N |
| XLogP | 5.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|