C28H35N3O3 — CID 51071042
N-[(1R,2R)-2-benzamidocyclohexyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide (PubChem CID 51071042) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzamidocyclohexyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51071042 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1NC(=O)C1CCN(C(=O)CCc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H35N3O3/c32-26(16-15-21-9-3-1-4-10-21)31-19-17-23(18-20-31)28(34)30-25-14-8-7-13-24(25)29-27(33)22-11-5-2-6-12-22/h1-6,9-12,23-25H,7-8,13-20H2,(H,29,33)(H,30,34)/t24-,25-/m1/s1 |
| InChIKey | HMETZGUXZRYWDF-JWQCQUIFSA-N |
| XLogP | 3.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |