C22H32N4O3 — CID 46103923
4-N-[(2R)-2-benzamidocyclohexyl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide (PubChem CID 46103923) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-N-[(2R)-2-benzamidocyclohexyl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[(2R)-2-benzamidocyclohexyl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 46103923 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-N-[(2R)-2-benzamidocyclohexyl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCC(C(=O)NC2CCCC[C@H]2NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H32N4O3/c1-25(2)22(29)26-14-12-17(13-15-26)21(28)24-19-11-7-6-10-18(19)23-20(27)16-8-4-3-5-9-16/h3-5,8-9,17-19H,6-7,10-15H2,1-2H3,(H,23,27)(H,24,28)/t18-,19?/m1/s1 |
| InChIKey | QKROATTVGKNDNV-MRTLOADZSA-N |
| XLogP | 2.24 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |