C25H29Cl2N3O4S — CID 51071677
N-[(1R,2R)-2-benzamidocyclohexyl]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 51071677) has the molecular formula C25H29Cl2N3O4S and a molecular weight of 538.50 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzamidocyclohexyl]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51071677 |
| Molecular Formula | C25H29Cl2N3O4S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1NC(=O)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H29Cl2N3O4S/c26-19-10-11-20(27)23(16-19)35(33,34)30-14-12-18(13-15-30)25(32)29-22-9-5-4-8-21(22)28-24(31)17-6-2-1-3-7-17/h1-3,6-7,10-11,16,18,21-22H,4-5,8-9,12-15H2,(H,28,31)(H,29,32)/t21-,22-/m1/s1 |
| InChIKey | VKCZVHKSIFVTFA-FGZHOGPDSA-N |
| XLogP | 4.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |