C29H33N3O4S — CID 51071217
N-[(1R,2R)-2-benzamidocyclohexyl]-1-naphthalen-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 51071217) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzamidocyclohexyl]-1-naphthalen-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-naphthalen-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51071217 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-naphthalen-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1NC(=O)C1CCN(S(=O)(=O)c2cccc3ccccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H33N3O4S/c33-28(22-10-2-1-3-11-22)30-25-14-6-7-15-26(25)31-29(34)23-17-19-32(20-18-23)37(35,36)27-16-8-12-21-9-4-5-13-24(21)27/h1-5,8-13,16,23,25-26H,6-7,14-15,17-20H2,(H,30,33)(H,31,34)/t25-,26-/m1/s1 |
| InChIKey | LVFZETAZNOERFP-CLJLJLNGSA-N |
| XLogP | 4.10 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |