C21H31N3O4S — CID 51071678
N-[(1R,2R)-2-benzamidocyclohexyl]-1-ethylsulfonylpiperidine-4-carboxamide (PubChem CID 51071678) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzamidocyclohexyl]-1-ethylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-ethylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51071678 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[(1R,2R)-2-benzamidocyclohexyl]-1-ethylsulfonylpiperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)N[C@@H]2CCCC[C@H]2NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N3O4S/c1-2-29(27,28)24-14-12-17(13-15-24)21(26)23-19-11-7-6-10-18(19)22-20(25)16-8-4-3-5-9-16/h3-5,8-9,17-19H,2,6-7,10-15H2,1H3,(H,22,25)(H,23,26)/t18-,19-/m1/s1 |
| InChIKey | JBTAUGXIOMJWTJ-RTBURBONSA-N |
| XLogP | 1.91 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |