C23H28N2O7S2 — CID 172962335
(1E)-1-(4-cyclopropylsulfonylphenyl)-3-[5-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]-1-[(3R)-oxolan-3-yl]oxyiminopropan-2-one (PubChem CID 172962335) has the molecular formula C23H28N2O7S2 and a molecular weight of 508.62 g/mol. Its IUPAC name is (1E)-1-(4-cyclopropylsulfonylphenyl)-3-[5-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]-1-[(3R)-oxolan-3-yl]oxyiminopropan-2-one.
| Compound Name | (1E)-1-(4-cyclopropylsulfonylphenyl)-3-[5-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]-1-[(3R)-oxolan-3-yl]oxyiminopropan-2-one |
|---|---|
| PubChem CID | 172962335 |
| Molecular Formula | C23H28N2O7S2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (1E)-1-(4-cyclopropylsulfonylphenyl)-3-[5-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]-1-[(3R)-oxolan-3-yl]oxyiminopropan-2-one |
| SMILES | COCCOCc1cnc(CC(=O)/C(=N/O[C@@H]2CCOC2)c2ccc(S(=O)(=O)C3CC3)cc2)s1 |
| InChI | InChI=1S/C23H28N2O7S2/c1-29-10-11-31-15-18-13-24-22(33-18)12-21(26)23(25-32-17-8-9-30-14-17)16-2-4-19(5-3-16)34(27,28)20-6-7-20/h2-5,13,17,20H,6-12,14-15H2,1H3/b25-23+/t17-/m1/s1 |
| InChIKey | JNZYBFUNZNLOLQ-UFHFJWEESA-N |
| XLogP | 2.56 |
| TPSA | 113.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|