C20H22F2N2O4S2 — CID 123572673
3-[(3S,4R)-3,4-difluorocyclopentyl]-2-[4-(2-methoxyethylsulfonyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 123572673) has the molecular formula C20H22F2N2O4S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-[(3S,4R)-3,4-difluorocyclopentyl]-2-[4-(2-methoxyethylsulfonyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[(3S,4R)-3,4-difluorocyclopentyl]-2-[4-(2-methoxyethylsulfonyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 123572673 |
| Molecular Formula | C20H22F2N2O4S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 3-[(3S,4R)-3,4-difluorocyclopentyl]-2-[4-(2-methoxyethylsulfonyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COCCS(=O)(=O)c1ccc(C(=CC2C[C@@H](F)[C@@H](F)C2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C20H22F2N2O4S2/c1-28-7-9-30(26,27)15-4-2-14(3-5-15)16(10-13-11-17(21)18(22)12-13)19(25)24-20-23-6-8-29-20/h2-6,8,10,13,17-18H,7,9,11-12H2,1H3,(H,23,24,25)/t13?,17-,18+ |
| InChIKey | COXYCEGEUJZWIO-CNUNBNKRSA-N |
| XLogP | 3.67 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|