C16H13N3O3S3 — CID 10249892
(E)-2-(4-methylsulfonylphenyl)-N,3-bis(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 10249892) has the molecular formula C16H13N3O3S3 and a molecular weight of 391.50 g/mol. Its IUPAC name is (E)-2-(4-methylsulfonylphenyl)-N,3-bis(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-(4-methylsulfonylphenyl)-N,3-bis(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10249892 |
| Molecular Formula | C16H13N3O3S3 |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (E)-2-(4-methylsulfonylphenyl)-N,3-bis(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\c2nccs2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C16H13N3O3S3/c1-25(21,22)12-4-2-11(3-5-12)13(10-14-17-6-8-23-14)15(20)19-16-18-7-9-24-16/h2-10H,1H3,(H,18,19,20)/b13-10+ |
| InChIKey | LFHWQRNWABSAOQ-JLHYYAGUSA-N |
| XLogP | 3.18 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|