C17H13ClN2O3S3 — CID 10025410
(E)-N-(5-chloro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-thiophen-3-ylprop-2-enamide (PubChem CID 10025410) has the molecular formula C17H13ClN2O3S3 and a molecular weight of 424.96 g/mol. Its IUPAC name is (E)-N-(5-chloro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-(5-chloro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 10025410 |
| Molecular Formula | C17H13ClN2O3S3 |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | (E)-N-(5-chloro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-thiophen-3-ylprop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\c2ccsc2)C(=O)Nc2ncc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H13ClN2O3S3/c1-26(22,23)13-4-2-12(3-5-13)14(8-11-6-7-24-10-11)16(21)20-17-19-9-15(18)25-17/h2-10H,1H3,(H,19,20,21)/b14-8+ |
| InChIKey | PANGSNIFWZSJFA-RIYZIHGNSA-N |
| XLogP | 4.44 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|