C16H10B2N2OS2 — CID 89092361
CID 89092361 (PubChem CID 89092361) has the molecular formula C16H10B2N2OS2 and a molecular weight of 332.03 g/mol.
| Compound Name | CID 89092361 |
|---|---|
| PubChem CID | 89092361 |
| Molecular Formula | C16H10B2N2OS2 |
| Molecular Weight | 332.03 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(/C(=C\c2cccs2)C(=O)Nc2ncc([B])s2)cc1 |
| InChI | InChI=1S/C16H10B2N2OS2/c17-11-5-3-10(4-6-11)13(8-12-2-1-7-22-12)15(21)20-16-19-9-14(18)23-16/h1-9H,(H,19,20,21)/b13-8+ |
| InChIKey | MRCFHTRVAHQRHW-MDWZMJQESA-N |
| XLogP | 1.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.03 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|