C17H10N4O2S3 — CID 10739641
(E)-2-cyano-N-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 10739641) has the molecular formula C17H10N4O2S3 and a molecular weight of 398.49 g/mol. Its IUPAC name is (E)-2-cyano-N-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 10739641 |
| Molecular Formula | C17H10N4O2S3 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | (E)-2-cyano-N-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1cccs1)C(=O)NC(=S)NC(=O)/C(C#N)=C/c1cccs1 |
| InChI | InChI=1S/C17H10N4O2S3/c18-9-11(7-13-3-1-5-25-13)15(22)20-17(24)21-16(23)12(10-19)8-14-4-2-6-26-14/h1-8H,(H2,20,21,22,23,24)/b11-7+,12-8+ |
| InChIKey | IEZSCJPVIGSOOH-MKICQXMISA-N |
| XLogP | 2.84 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|