C11H10N2OS — CID 2688672
(E)-2-cyano-N-prop-2-enyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 2688672) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is (E)-2-cyano-N-prop-2-enyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-prop-2-enyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 2688672 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (E)-2-cyano-N-prop-2-enyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | C=CCNC(=O)/C(C#N)=C/c1cccs1 |
| InChI | InChI=1S/C11H10N2OS/c1-2-5-13-11(14)9(8-12)7-10-4-3-6-15-10/h2-4,6-7H,1,5H2,(H,13,14)/b9-7+ |
| InChIKey | ZNLZVSDZHMYYFH-VQHVLOKHSA-N |
| XLogP | 1.96 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|