C20H15ClF3N3OS — CID 1485137
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-2-phenyl-3-thiophen-2-ylprop-2-enehydrazide (PubChem CID 1485137) has the molecular formula C20H15ClF3N3OS and a molecular weight of 437.87 g/mol. Its IUPAC name is N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-2-phenyl-3-thiophen-2-ylprop-2-enehydrazide.
| Compound Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-2-phenyl-3-thiophen-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 1485137 |
| Molecular Formula | C20H15ClF3N3OS |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-2-phenyl-3-thiophen-2-ylprop-2-enehydrazide |
| SMILES | CN(NC(=O)C(=Cc1cccs1)c1ccccc1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H15ClF3N3OS/c1-27(18-17(21)10-14(12-25-18)20(22,23)24)26-19(28)16(11-15-8-5-9-29-15)13-6-3-2-4-7-13/h2-12H,1H3,(H,26,28) |
| InChIKey | WLTHTNFYOVHENE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|