C10H11ClF3N5O2 — CID 135426551
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(methoxyiminomethyl)urea (PubChem CID 135426551) has the molecular formula C10H11ClF3N5O2 and a molecular weight of 325.68 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(methoxyiminomethyl)urea.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(methoxyiminomethyl)urea |
|---|---|
| PubChem CID | 135426551 |
| Molecular Formula | C10H11ClF3N5O2 |
| Molecular Weight | 325.68 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(methoxyiminomethyl)urea |
| SMILES | CON=CNC(=O)NN(C)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3N5O2/c1-19(18-9(20)16-5-17-21-2)8-7(11)3-6(4-15-8)10(12,13)14/h3-5H,1-2H3,(H2,16,17,18,20) |
| InChIKey | SBDZMVFRZYDHMV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|