About 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate (PubChem CID 158730387) has the molecular formula C17H14Cl3F3N2O2
and a molecular weight of 441.66 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate |
| PubChem CID | 158730387 |
| Molecular Formula | C17H14Cl3F3N2O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate |
| SMILES | CN(CCOC(=O)Cc1cc(Cl)cc(Cl)c1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H14Cl3F3N2O2/c1-25(16-14(20)7-11(9-24-16)17(21,22)23)2-3-27-15(26)6-10-4-12(18)8-13(19)5-10/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | ILAGSXJEYSVDKW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate?
The IUPAC name of 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate (CID 158730387) is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate.
What is the SMILES notation for 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate?
The canonical SMILES for 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate is CN(CCOC(=O)Cc1cc(Cl)cc(Cl)c1)c1ncc(C(F)(F)F)cc1Cl.
What is the InChIKey of 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate?
The InChIKey is ILAGSXJEYSVDKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl3F3N2O2/c1-25(16-14(20)7-11(9-24-16)17(21,22)23)2-3-27-15(26)6-10-4-12(18)8-13(19)5-10/h4-5,7-9H,2-3,6H2,1H3.
What are the key properties of 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate?
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate has a molecular weight of 441.66 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]ethyl 2-(3,5-dichlorophenyl)acetate is sourced from PubChem (CID 158730387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).