C12H14ClF3N2O2 — CID 62825663
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-ethylamino]butanoic acid (PubChem CID 62825663) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-ethylamino]butanoic acid.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 62825663 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-ethylamino]butanoic acid |
| SMILES | CCN(c1ncc(C(F)(F)F)cc1Cl)C(C)CC(=O)O |
| InChI | InChI=1S/C12H14ClF3N2O2/c1-3-18(7(2)4-10(19)20)11-9(13)5-8(6-17-11)12(14,15)16/h5-7H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | FLRHSAZGAQYGJX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |