C11H13BrClF3N2 — CID 80670303
N-(2-bromoethyl)-3-chloro-N-propan-2-yl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 80670303) has the molecular formula C11H13BrClF3N2 and a molecular weight of 345.59 g/mol. Its IUPAC name is N-(2-bromoethyl)-3-chloro-N-propan-2-yl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-bromoethyl)-3-chloro-N-propan-2-yl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 80670303 |
| Molecular Formula | C11H13BrClF3N2 |
| Molecular Weight | 345.59 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | N-(2-bromoethyl)-3-chloro-N-propan-2-yl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)N(CCBr)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H13BrClF3N2/c1-7(2)18(4-3-12)10-9(13)5-8(6-17-10)11(14,15)16/h5-7H,3-4H2,1-2H3 |
| InChIKey | FRKDVJVMCRGYOA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|