About 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide
2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 85152597) has the molecular formula C17H11N3OS2
and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
Molecular Properties
| Compound Name | 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| PubChem CID | 85152597 |
| Molecular Formula | C17H11N3OS2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | N#Cc1ccc(C(=Cc2cccs2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C17H11N3OS2/c18-11-12-3-5-13(6-4-12)15(10-14-2-1-8-22-14)16(21)20-17-19-7-9-23-17/h1-10H,(H,19,20,21) |
| InChIKey | JBRKRIQOFHXRNU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide?
The IUPAC name of 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (CID 85152597) is 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
What is the SMILES notation for 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide?
The canonical SMILES for 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide is N#Cc1ccc(C(=Cc2cccs2)C(=O)Nc2nccs2)cc1.
What is the InChIKey of 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide?
The InChIKey is JBRKRIQOFHXRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3OS2/c18-11-12-3-5-13(6-4-12)15(10-14-2-1-8-22-14)16(21)20-17-19-7-9-23-17/h1-10H,(H,19,20,21).
What are the key properties of 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide?
2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide has a molecular weight of 337.43 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyanophenyl)-N-(1,3-thiazol-2-yl)-3-thiophen-2-ylprop-2-enamide is sourced from PubChem (CID 85152597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).