C20H13BrN2OS2 — CID 87417205
N-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 87417205) has the molecular formula C20H13BrN2OS2 and a molecular weight of 441.38 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 87417205 |
| Molecular Formula | C20H13BrN2OS2 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(Nc1nc2ccccc2s1)C(=Cc1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H13BrN2OS2/c21-14-9-7-13(8-10-14)16(12-15-4-3-11-25-15)19(24)23-20-22-17-5-1-2-6-18(17)26-20/h1-12H,(H,22,23,24) |
| InChIKey | JSRPLUUDKRRWGT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|