C13H11NO2S — CID 11379581
(E)-N-hydroxy-2-phenyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 11379581) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is (E)-N-hydroxy-2-phenyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-hydroxy-2-phenyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 11379581 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (E)-N-hydroxy-2-phenyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(NO)/C(=C/c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C13H11NO2S/c15-13(14-16)12(9-11-7-4-8-17-11)10-5-2-1-3-6-10/h1-9,16H,(H,14,15)/b12-9+ |
| InChIKey | HLIPGXQBTMJDPC-FMIVXFBMSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|