C21H20N2O5S2 — CID 10049120
3-[2-(hydroxymethyl)prop-2-enyl]-5-(4-methylsulfonylphenoxy)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 10049120) has the molecular formula C21H20N2O5S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)prop-2-enyl]-5-(4-methylsulfonylphenoxy)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[2-(hydroxymethyl)prop-2-enyl]-5-(4-methylsulfonylphenoxy)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 10049120 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-[2-(hydroxymethyl)prop-2-enyl]-5-(4-methylsulfonylphenoxy)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | C=C(CO)Cc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C21H20N2O5S2/c1-14(13-24)9-15-10-16(20(25)23-21-22-7-8-29-21)12-18(11-15)28-17-3-5-19(6-4-17)30(2,26)27/h3-8,10-12,24H,1,9,13H2,2H3,(H,22,23,25) |
| InChIKey | RWEVKEZBNUWJHS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|