C22H24N2O5S2 — CID 141099322
3-(4-methylsulfonylphenoxy)-2-pentoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 141099322) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenoxy)-2-pentoxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(4-methylsulfonylphenoxy)-2-pentoxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 141099322 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 3-(4-methylsulfonylphenoxy)-2-pentoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCCCCOc1c(Oc2ccc(S(C)(=O)=O)cc2)cccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C22H24N2O5S2/c1-3-4-5-14-28-20-18(21(25)24-22-23-13-15-30-22)7-6-8-19(20)29-16-9-11-17(12-10-16)31(2,26)27/h6-13,15H,3-5,14H2,1-2H3,(H,23,24,25) |
| InChIKey | ZSAHIVKVUOEKOU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|