C24H31N3O5S2 — CID 76674848
3-cyclopentyl-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-[4-(ethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 76674848) has the molecular formula C24H31N3O5S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is 3-cyclopentyl-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-[4-(ethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | 3-cyclopentyl-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76674848 |
| Molecular Formula | C24H31N3O5S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 3-cyclopentyl-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=CC2CCCC2)C(=O)Nc2nc(C3COC(C)(C)O3)cs2)cc1 |
| InChI | InChI=1S/C24H31N3O5S2/c1-4-25-34(29,30)18-11-9-17(10-12-18)19(13-16-7-5-6-8-16)22(28)27-23-26-20(15-33-23)21-14-31-24(2,3)32-21/h9-13,15-16,21,25H,4-8,14H2,1-3H3,(H,26,27,28) |
| InChIKey | XTODSWBUPWEEFZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|