C19H24F2O3S — CID 67252078
ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-[4-(1-methoxyethylsulfanyl)phenyl]prop-2-enoate (PubChem CID 67252078) has the molecular formula C19H24F2O3S and a molecular weight of 370.46 g/mol. Its IUPAC name is ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-[4-(1-methoxyethylsulfanyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-[4-(1-methoxyethylsulfanyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67252078 |
| Molecular Formula | C19H24F2O3S |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl (E)-3-[(3R,4S)-3,4-difluorocyclopentyl]-2-[4-(1-methoxyethylsulfanyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1C[C@@H](F)[C@@H](F)C1)c1ccc(SC(C)OC)cc1 |
| InChI | InChI=1S/C19H24F2O3S/c1-4-24-19(22)16(9-13-10-17(20)18(21)11-13)14-5-7-15(8-6-14)25-12(2)23-3/h5-9,12-13,17-18H,4,10-11H2,1-3H3/b16-9+/t12?,13?,17-,18+ |
| InChIKey | ZFMNCECZFRHJHA-XOUBUBAESA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|