C6H10N4O3S — CID 143957938
(NZ)-N-[1-(5-amino-1,2,4-thiadiazol-3-yl)ethylidene]hydroxylamine;methyl formate (PubChem CID 143957938) has the molecular formula C6H10N4O3S and a molecular weight of 218.24 g/mol. Its IUPAC name is (NZ)-N-[1-(5-amino-1,2,4-thiadiazol-3-yl)ethylidene]hydroxylamine;methyl formate.
| Compound Name | (NZ)-N-[1-(5-amino-1,2,4-thiadiazol-3-yl)ethylidene]hydroxylamine;methyl formate |
|---|---|
| PubChem CID | 143957938 |
| Molecular Formula | C6H10N4O3S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (NZ)-N-[1-(5-amino-1,2,4-thiadiazol-3-yl)ethylidene]hydroxylamine;methyl formate |
| SMILES | C/C(=N/O)c1nsc(N)n1.COC=O |
| InChI | InChI=1S/C4H6N4OS.C2H4O2/c1-2(7-9)3-6-4(5)10-8-3;1-4-2-3/h9H,1H3,(H2,5,6,8);2H,1H3/b7-2-; |
| InChIKey | XYHAJSZEQGFNIP-YMWUIOJXSA-N |
| XLogP | 0.11 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|