C7H9N4O2PS — CID 91610042
methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(methylidenephosphanylmethylimino)acetate (PubChem CID 91610042) has the molecular formula C7H9N4O2PS and a molecular weight of 244.22 g/mol. Its IUPAC name is methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(methylidenephosphanylmethylimino)acetate.
| Compound Name | methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(methylidenephosphanylmethylimino)acetate |
|---|---|
| PubChem CID | 91610042 |
| Molecular Formula | C7H9N4O2PS |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(methylidenephosphanylmethylimino)acetate |
| SMILES | C=PCN=C(C(=O)OC)c1nsc(N)n1 |
| InChI | InChI=1S/C7H9N4O2PS/c1-13-6(12)4(9-3-14-2)5-10-7(8)15-11-5/h2-3H2,1H3,(H2,8,10,11) |
| InChIKey | QABDILCMVLRXFN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|