C5H6N4O5S2 — CID 136950450
methylsulfonyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetate (PubChem CID 136950450) has the molecular formula C5H6N4O5S2 and a molecular weight of 266.26 g/mol. Its IUPAC name is methylsulfonyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetate.
| Compound Name | methylsulfonyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 136950450 |
| Molecular Formula | C5H6N4O5S2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | methylsulfonyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetate |
| SMILES | CS(=O)(=O)OC(=O)/C(=N\O)c1nsc(N)n1 |
| InChI | InChI=1S/C5H6N4O5S2/c1-16(12,13)14-4(10)2(8-11)3-7-5(6)15-9-3/h11H,1H3,(H2,6,7,9)/b8-2- |
| InChIKey | REIIVWWETYPRKE-WAPJZHGLSA-N |
| XLogP | -1.20 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|