C7H9N3O5S2 — CID 90408096
methylsulfonyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate (PubChem CID 90408096) has the molecular formula C7H9N3O5S2 and a molecular weight of 279.30 g/mol. Its IUPAC name is methylsulfonyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate.
| Compound Name | methylsulfonyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 90408096 |
| Molecular Formula | C7H9N3O5S2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | methylsulfonyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
| SMILES | CO/N=C(\C(=O)OS(C)(=O)=O)c1csc(N)n1 |
| InChI | InChI=1S/C7H9N3O5S2/c1-14-10-5(4-3-16-7(8)9-4)6(11)15-17(2,12)13/h3H,1-2H3,(H2,8,9)/b10-5- |
| InChIKey | REZAWBCHEOFOMP-YHYXMXQVSA-N |
| XLogP | -0.42 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|