C8H12N4O6S2 — CID 172922618
2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-1-hydroxyethanesulfonic acid (PubChem CID 172922618) has the molecular formula C8H12N4O6S2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-1-hydroxyethanesulfonic acid.
| Compound Name | 2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-1-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 172922618 |
| Molecular Formula | C8H12N4O6S2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-1-hydroxyethanesulfonic acid |
| SMILES | CO/N=C(\C(=O)NCC(O)S(=O)(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C8H12N4O6S2/c1-18-12-6(4-3-19-8(9)11-4)7(14)10-2-5(13)20(15,16)17/h3,5,13H,2H2,1H3,(H2,9,11)(H,10,14)(H,15,16,17)/b12-6- |
| InChIKey | MCPCAZNTYDHBEB-SDQBBNPISA-N |
| XLogP | -1.60 |
| TPSA | 164.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|