C6H6BrN3O3S — CID 174309981
bromo 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate (PubChem CID 174309981) has the molecular formula C6H6BrN3O3S and a molecular weight of 280.10 g/mol. Its IUPAC name is bromo 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate.
| Compound Name | bromo 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 174309981 |
| Molecular Formula | C6H6BrN3O3S |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 278.93 |
| IUPAC Name | bromo 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
| SMILES | CON=C(C(=O)OBr)c1csc(N)n1 |
| InChI | InChI=1S/C6H6BrN3O3S/c1-12-10-4(5(11)13-7)3-2-14-6(8)9-3/h2H,1H3,(H2,8,9) |
| InChIKey | VLKYJQJLARHKCH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|