C10H11N3O5S — CID 164916050
1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid (PubChem CID 164916050) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid.
| Compound Name | 1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 164916050 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethylidene]amino]oxycyclopropane-1-carboxylic acid |
| SMILES | COC(=O)/C(=N\OC1(C(=O)O)CC1)c1csc(N)n1 |
| InChI | InChI=1S/C10H11N3O5S/c1-17-7(14)6(5-4-19-9(11)12-5)13-18-10(2-3-10)8(15)16/h4H,2-3H2,1H3,(H2,11,12)(H,15,16)/b13-6- |
| InChIKey | YDTQBHPMLYBQSV-MLPAPPSSSA-N |
| XLogP | 0.24 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|