C9H11N3O4S — CID 11777216
ethyl (2Z)-3-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-3-oxopropanoate (PubChem CID 11777216) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is ethyl (2Z)-3-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-3-oxopropanoate.
| Compound Name | ethyl (2Z)-3-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-3-oxopropanoate |
|---|---|
| PubChem CID | 11777216 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | ethyl (2Z)-3-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-3-oxopropanoate |
| SMILES | CCOC(=O)/C(=N\OC)C(=O)c1csc(N)n1 |
| InChI | InChI=1S/C9H11N3O4S/c1-3-16-8(14)6(12-15-2)7(13)5-4-17-9(10)11-5/h4H,3H2,1-2H3,(H2,10,11)/b12-6- |
| InChIKey | YKZDFOABQRAUAQ-SDQBBNPISA-N |
| XLogP | 0.47 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|