C9H12N2O3S — CID 15053527
2-methylpropyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate (PubChem CID 15053527) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-methylpropyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate.
| Compound Name | 2-methylpropyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 15053527 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-methylpropyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate |
| SMILES | CC(C)COC(=O)C(=O)c1csc(N)n1 |
| InChI | InChI=1S/C9H12N2O3S/c1-5(2)3-14-8(13)7(12)6-4-15-9(10)11-6/h4-5H,3H2,1-2H3,(H2,10,11) |
| InChIKey | ZNZXXALJGNVEPN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|