C14H22N2O2S — CID 54365133
propan-2-yl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate (PubChem CID 54365133) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is propan-2-yl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate.
| Compound Name | propan-2-yl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate |
|---|---|
| PubChem CID | 54365133 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | propan-2-yl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate |
| SMILES | CCCCCC=C(C(=O)OC(C)C)c1csc(N)n1 |
| InChI | InChI=1S/C14H22N2O2S/c1-4-5-6-7-8-11(13(17)18-10(2)3)12-9-19-14(15)16-12/h8-10H,4-7H2,1-3H3,(H2,15,16) |
| InChIKey | UPGJMRCVHYMLDM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|