C9H14N2OS — CID 102530242
1-(2-amino-1,3-thiazol-4-yl)hexan-1-one (PubChem CID 102530242) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazol-4-yl)hexan-1-one.
| Compound Name | 1-(2-amino-1,3-thiazol-4-yl)hexan-1-one |
|---|---|
| PubChem CID | 102530242 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(2-amino-1,3-thiazol-4-yl)hexan-1-one |
| SMILES | CCCCCC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C9H14N2OS/c1-2-3-4-5-8(12)7-6-13-9(10)11-7/h6H,2-5H2,1H3,(H2,10,11) |
| InChIKey | OTNALKHDTDHFHL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|