C15H24N2O2S — CID 54268895
tert-butyl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate (PubChem CID 54268895) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is tert-butyl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate.
| Compound Name | tert-butyl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate |
|---|---|
| PubChem CID | 54268895 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl 2-(2-amino-1,3-thiazol-4-yl)oct-2-enoate |
| SMILES | CCCCCC=C(C(=O)OC(C)(C)C)c1csc(N)n1 |
| InChI | InChI=1S/C15H24N2O2S/c1-5-6-7-8-9-11(12-10-20-14(16)17-12)13(18)19-15(2,3)4/h9-10H,5-8H2,1-4H3,(H2,16,17) |
| InChIKey | RITCHOSHNXFHQB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|