C13H19N3O4S — CID 173407476
tert-butyl 3-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 173407476) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is tert-butyl 3-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | tert-butyl 3-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 173407476 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | tert-butyl 3-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CC(CO/N=C(\C=O)c1csc(N)n1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19N3O4S/c1-8(11(18)20-13(2,3)4)6-19-16-9(5-17)10-7-21-12(14)15-10/h5,7-8H,6H2,1-4H3,(H2,14,15)/b16-9+ |
| InChIKey | DEZVLPYJCYNYQT-CXUHLZMHSA-N |
| XLogP | 1.62 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|