C15H23N3O7S2 — CID 173336450
1-ethylsulfonylethyl 2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetate (PubChem CID 173336450) has the molecular formula C15H23N3O7S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 1-ethylsulfonylethyl 2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetate.
| Compound Name | 1-ethylsulfonylethyl 2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetate |
|---|---|
| PubChem CID | 173336450 |
| Molecular Formula | C15H23N3O7S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-ethylsulfonylethyl 2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetate |
| SMILES | CCS(=O)(=O)C(C)OC(=O)C(=NOCC(=O)OC(C)(C)C)c1csc(N)n1 |
| InChI | InChI=1S/C15H23N3O7S2/c1-6-27(21,22)9(2)24-13(20)12(10-8-26-14(16)17-10)18-23-7-11(19)25-15(3,4)5/h8-9H,6-7H2,1-5H3,(H2,16,17) |
| InChIKey | LBSJLLKRXNFPOA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|