C20H25N3O5S2 — CID 173336430
tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(1-phenylsulfanylethoxy)ethylidene]amino]oxypropanoate (PubChem CID 173336430) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(1-phenylsulfanylethoxy)ethylidene]amino]oxypropanoate.
| Compound Name | tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(1-phenylsulfanylethoxy)ethylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 173336430 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(1-phenylsulfanylethoxy)ethylidene]amino]oxypropanoate |
| SMILES | CC(OC(=O)C(=NOC(C)C(=O)OC(C)(C)C)c1csc(N)n1)Sc1ccccc1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-12(17(24)27-20(3,4)5)28-23-16(15-11-29-19(21)22-15)18(25)26-13(2)30-14-9-7-6-8-10-14/h6-13H,1-5H3,(H2,21,22) |
| InChIKey | ZNSUAYAFDXSFIX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|