C16H25N3O7S2 — CID 173336432
tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-(1-methylsulfonylethoxy)-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 173336432) has the molecular formula C16H25N3O7S2 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-(1-methylsulfonylethoxy)-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-(1-methylsulfonylethoxy)-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 173336432 |
| Molecular Formula | C16H25N3O7S2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | tert-butyl 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-(1-methylsulfonylethoxy)-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CC(OC(=O)C(=NOC(C)(C)C(=O)OC(C)(C)C)c1csc(N)n1)S(C)(=O)=O |
| InChI | InChI=1S/C16H25N3O7S2/c1-9(28(7,22)23)24-12(20)11(10-8-27-14(17)18-10)19-26-16(5,6)13(21)25-15(2,3)4/h8-9H,1-7H3,(H2,17,18) |
| InChIKey | HXFSQJBEZCJUBA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|