C13H20N6O8S2 — CID 57369235
2-[[2-(1-amino-2-methyl-1-oxopropan-2-yl)oxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(sulfoamino)butanoic acid (PubChem CID 57369235) has the molecular formula C13H20N6O8S2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-[[2-(1-amino-2-methyl-1-oxopropan-2-yl)oxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(sulfoamino)butanoic acid.
| Compound Name | 2-[[2-(1-amino-2-methyl-1-oxopropan-2-yl)oxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(sulfoamino)butanoic acid |
|---|---|
| PubChem CID | 57369235 |
| Molecular Formula | C13H20N6O8S2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[[2-(1-amino-2-methyl-1-oxopropan-2-yl)oxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-(sulfoamino)butanoic acid |
| SMILES | CC(NS(=O)(=O)O)C(NC(=O)C(=NOC(C)(C)C(N)=O)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C13H20N6O8S2/c1-5(19-29(24,25)26)7(10(21)22)17-9(20)8(6-4-28-12(15)16-6)18-27-13(2,3)11(14)23/h4-5,7,19H,1-3H3,(H2,14,23)(H2,15,16)(H,17,20)(H,21,22)(H,24,25,26) |
| InChIKey | SOFNQUFSURUYTQ-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 236.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|