C18H25N5O8S2 — CID 54500573
2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-cyclohexyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 54500573) has the molecular formula C18H25N5O8S2 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-cyclohexyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-cyclohexyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 54500573 |
| Molecular Formula | C18H25N5O8S2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-cyclohexyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(ON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@@H]1C1CCCCC1)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C18H25N5O8S2/c1-18(2,16(26)27)31-22-11(10-8-32-17(19)20-10)14(24)21-12-13(9-6-4-3-5-7-9)23(15(12)25)33(28,29)30/h8-9,12-13H,3-7H2,1-2H3,(H2,19,20)(H,21,24)(H,26,27)(H,28,29,30)/t12-,13-/m1/s1 |
| InChIKey | YCCUPGOYPUTYIZ-CHWSQXEVSA-N |
| XLogP | 0.39 |
| TPSA | 201.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|