C12H14N8O8S2 — CID 14257313
2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-azido-4-oxo-1-sulfoazetidin-3-yl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 14257313) has the molecular formula C12H14N8O8S2 and a molecular weight of 462.43 g/mol. Its IUPAC name is 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-azido-4-oxo-1-sulfoazetidin-3-yl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-azido-4-oxo-1-sulfoazetidin-3-yl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 14257313 |
| Molecular Formula | C12H14N8O8S2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-azido-4-oxo-1-sulfoazetidin-3-yl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(O/N=C(/C(=O)NC1C(=O)N(S(=O)(=O)O)C1N=[N+]=[N-])c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C12H14N8O8S2/c1-12(2,10(23)24)28-18-5(4-3-29-11(13)15-4)8(21)16-6-7(17-19-14)20(9(6)22)30(25,26)27/h3,6-7H,1-2H3,(H2,13,15)(H,16,21)(H,23,24)(H,25,26,27)/b18-5+ |
| InChIKey | GOFQXMKTAKIGQV-BLLMUTORSA-N |
| XLogP | -0.92 |
| TPSA | 250.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|