C15H19N5O10S2 — CID 57302925
2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(1-methoxy-2-oxoethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 57302925) has the molecular formula C15H19N5O10S2 and a molecular weight of 493.48 g/mol. Its IUPAC name is 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(1-methoxy-2-oxoethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(1-methoxy-2-oxoethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 57302925 |
| Molecular Formula | C15H19N5O10S2 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(1-methoxy-2-oxoethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | COC(C=O)C1C(NC(=O)C(=NOC(C)(C)C(=O)O)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C15H19N5O10S2/c1-15(2,13(24)25)30-19-8(6-5-31-14(16)17-6)11(22)18-9-10(7(4-21)29-3)20(12(9)23)32(26,27)28/h4-5,7,9-10H,1-3H3,(H2,16,17)(H,18,22)(H,24,25)(H,26,27,28) |
| InChIKey | NCAFUEPYUDJWSJ-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 227.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|