C14H18N8O10S2 — CID 54313965
2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-[(carbamoylamino)carbamoyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 54313965) has the molecular formula C14H18N8O10S2 and a molecular weight of 522.48 g/mol. Its IUPAC name is 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-[(carbamoylamino)carbamoyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-[(carbamoylamino)carbamoyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 54313965 |
| Molecular Formula | C14H18N8O10S2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-[(carbamoylamino)carbamoyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(ON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1C(=O)NNC(N)=O)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C14H18N8O10S2/c1-14(2,11(26)27)32-21-5(4-3-33-13(16)17-4)8(23)18-6-7(9(24)19-20-12(15)28)22(10(6)25)34(29,30)31/h3,6-7H,1-2H3,(H2,16,17)(H,18,23)(H,19,24)(H,26,27)(H3,15,20,28)(H,29,30,31)/t6-,7-/m1/s1 |
| InChIKey | SMVQRJQZQGJIOU-RNFRBKRXSA-N |
| XLogP | -3.49 |
| TPSA | 285.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|